cas: 779-88-4 — see every product listed under this CAS number, including other names
2,5-Bis(trifluoromethyl)phenol, >95%, >95% (CAS 779-88-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FWC-1g |
| cas | 779-88-4 |
| size | 1g |
| availability | 49g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 650.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
2,5-bis(trifluoromethyl)phenol (CAS 779-88-4) is a chemical compound with the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)phenol. InChIKey: OJOPQGWFLQVKDU-UHFFFAOYSA-N.
| Molecular formula | C8H4F6O |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)phenol |
| InChIKey | OJOPQGWFLQVKDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)