cas: 381229-74-9 — see every product listed under this CAS number, including other names
2,5-DICHLORO-4-METHOXYBENZALDEHYDE, 98% (CAS 381229-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F795567-100MG |
| cas | 381229-74-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 789.32 Pln | |
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 1g | 3153.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,5-dichloro-4-methoxybenzaldehyde (CAS 381229-74-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2,5-dichloro-4-methoxybenzaldehyde. InChIKey: JUFGYSCJWDURGZ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2,5-dichloro-4-methoxybenzaldehyde |
| InChIKey | JUFGYSCJWDURGZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)Cl)C=O)Cl |
Computed by PubChem (NCBI)