cas: 2905-61-5 — see every product listed under this CAS number, including other names
2,5-Dichlorobenzoyl chloride, 98%, 98% (CAS 2905-61-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113VBY-1g |
| cas | 2905-61-5 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 25g | 318.80 Pln | |
| Chemat | 100g | 1101.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-dichlorobenzoyl chloride (CAS 2905-61-5) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,5-dichlorobenzoyl chloride. InChIKey: RSINFFVFOTUDEC-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,5-dichlorobenzoyl chloride |
| InChIKey | RSINFFVFOTUDEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)Cl)Cl |
Computed by PubChem (NCBI)