cas: 2905-61-5 — see every product listed under this CAS number, including other names
2,5-Dichlorobenzoyl Chloride, >98.0%(GC)(T) (CAS 2905-61-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2953-5G |
| cas | 2905-61-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 237.85 Pln | |
| TCI | 25g | 527.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,5-dichlorobenzoyl chloride (CAS 2905-61-5) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,5-dichlorobenzoyl chloride. InChIKey: RSINFFVFOTUDEC-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,5-dichlorobenzoyl chloride |
| InChIKey | RSINFFVFOTUDEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)Cl)Cl |
Computed by PubChem (NCBI)