cas: 2905-61-5 — see every product listed under this CAS number, including other names
2,5-Dichlorobenzoyl chloride, 97% (CAS 2905-61-5) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F062678-25G |
| cas | 2905-61-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 502.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,5-dichlorobenzoyl chloride (CAS 2905-61-5) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,5-dichlorobenzoyl chloride. InChIKey: RSINFFVFOTUDEC-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,5-dichlorobenzoyl chloride |
| InChIKey | RSINFFVFOTUDEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)Cl)Cl |
Computed by PubChem (NCBI)