CAS 19361-59-2 appears in our catalog under these names: 2,3,4-Trichlorobenzaldehyde, 98%, 2,3,4-Trichlorobenzaldehyde 98%, 2,3,4-trichlorobenzaldehyde, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
2,3,4-trichlorobenzaldehyde (CAS 19361-59-2) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,3,4-trichlorobenzaldehyde. InChIKey: WMOOOIUXYRHDEZ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,3,4-trichlorobenzaldehyde |
| InChIKey | WMOOOIUXYRHDEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)