cas: 94930-47-9 — see every product listed under this CAS number, including other names
2,5-Dimethoxy-4-formylbenzoic acid, 98%, 98% (CAS 94930-47-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12RE1Z-250mg |
| cas | 94930-47-9 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 1g | 1134.80 Pln | |
| Chemat | 5g | 4917.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-formyl-2,5-dimethoxybenzoic acid (CAS 94930-47-9) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 4-formyl-2,5-dimethoxybenzoic acid. InChIKey: LMINRADLQBBPIF-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 4-formyl-2,5-dimethoxybenzoic acid |
| InChIKey | LMINRADLQBBPIF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C=O)OC)C(=O)O |
Computed by PubChem (NCBI)