CAS 94930-47-9 appears in our catalog under these names: 2,5-Dimethoxy-4-formylbenzoic acid, 95%, 4-Formyl-2,5-dimethoxybenzoic acid 98%, 2,5-Dimethoxy-4-formylbenzoic acid, 98%, 98%, 2,5-Dimethoxy-4-formylbenzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
4-formyl-2,5-dimethoxybenzoic acid (CAS 94930-47-9) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 4-formyl-2,5-dimethoxybenzoic acid. InChIKey: LMINRADLQBBPIF-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 4-formyl-2,5-dimethoxybenzoic acid |
| InChIKey | LMINRADLQBBPIF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C=O)OC)C(=O)O |
Computed by PubChem (NCBI)