2,5-Dimethyl-4-nitrophenol, 98%
cas: 3139-05-7 — see every product listed under this CAS number, including other names
2,5-Dimethyl-4-nitrophenol, 98% (CAS 3139-05-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 100g, 250mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-4672-5g |
| cas | 3139-05-7 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 100g | price on request | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 375.94 Pln | |
| Ambeed | 100g | 1288.19 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 309.20 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 169.96 Pln | |
| BLDpharm | 25g | 403.22 Pln | |
| BLDpharm | 100g | 1380.65 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,5-dimethyl-4-nitrophenol (CAS 3139-05-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,5-dimethyl-4-nitrophenol. InChIKey: DSWZKAODNLLINU-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,5-dimethyl-4-nitrophenol |
| InChIKey | DSWZKAODNLLINU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)
