CAS 3139-05-7 appears in our catalog under these names: 2,5-Dimethyl-4-nitrophenol, 98%, 2,5-Dimethyl-4-nitrophenol 98%, 2,5-Dimethyl-4-nitrophenol, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 100g, 250mg.
2,5-dimethyl-4-nitrophenol (CAS 3139-05-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,5-dimethyl-4-nitrophenol. InChIKey: DSWZKAODNLLINU-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,5-dimethyl-4-nitrophenol |
| InChIKey | DSWZKAODNLLINU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)