cas: 55312-97-5 — see every product listed under this CAS number, including other names
2,5-Dimethylbenzeneacetyl chloride, 99% GC, 99% GC (CAS 55312-97-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDJD-1g |
| cas | 55312-97-5 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 25g | 515.60 Pln | |
| Chemat | 100g | 1869.20 Pln |
| purity | 99% GC |
|---|---|
| delivery time | 3 weeks |
2-(2,5-dimethylphenyl)acetyl chloride (CAS 55312-97-5) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)acetyl chloride. InChIKey: PZRANTBLOIKHJY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)acetyl chloride |
| InChIKey | PZRANTBLOIKHJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CC(=O)Cl |
Computed by PubChem (NCBI)