cas: 1393330-40-9 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 4,7,10,13,16-pentaoxanonadec-18-yn-1-oate, 95%, 95% (CAS 1393330-40-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HVJF-25mg |
| cas | 1393330-40-9 |
| size | 25mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 208.40 Pln | |
| Chemat | 50mg | 299.60 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1379.60 Pln | |
| Chemat | 5g | 4677.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 1393330-40-9) is a chemical compound with the molecular formula C18H27NO9 and a molecular weight of 401.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ACZDUKRWTPZVRP-UHFFFAOYSA-N.
| Molecular formula | C18H27NO9 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ACZDUKRWTPZVRP-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)