cas: 1393330-40-9 — see every product listed under this CAS number, including other names
Propargyl-PEG5-NHS ester 98% (CAS 1393330-40-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A677253-50mg |
| cas | 1393330-40-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 387.06 Pln | |
| Ambeed | 100mg | 598.44 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 1905.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A677253 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 1393330-40-9) is a chemical compound with the molecular formula C18H27NO9 and a molecular weight of 401.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ACZDUKRWTPZVRP-UHFFFAOYSA-N.
| Molecular formula | C18H27NO9 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ACZDUKRWTPZVRP-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)