cas: 917222-23-2 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl hept-6-ynoate, 98% (CAS 917222-23-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F781504-1G |
| cas | 917222-23-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1195.43 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2,5-dioxopyrrolidin-1-yl) hept-6-ynoate (CAS 917222-23-2) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) hept-6-ynoate. InChIKey: KENPLOYECFEPSG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) hept-6-ynoate |
| InChIKey | KENPLOYECFEPSG-UHFFFAOYSA-N |
| SMILES | C#CCCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)