cas: 5044-22-4 — see every product listed under this CAS number, including other names
2,5-dimethyl-1-(4-nitrophenyl)pyrrole (CAS 5044-22-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Biosynth, Chemat.
| brand | Biosynth |
|---|---|
| catalog number | FAA04422-250mg |
| cas | 5044-22-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 250mg | price on request | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1077.20 Pln | |
| Chemat | 25g | 4634.00 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Sourcing |
| purity | No data |
| delivery time | 2-3 weeks |
2,5-dimethyl-1-(4-nitrophenyl)pyrrole (CAS 5044-22-4) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 2,5-dimethyl-1-(4-nitrophenyl)pyrrole. InChIKey: JXJRCFOGAIXRCU-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 2,5-dimethyl-1-(4-nitrophenyl)pyrrole |
| InChIKey | JXJRCFOGAIXRCU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)