CAS 5044-22-4 appears in our catalog under these names: 2,5-dimethyl-1-(4-nitrophenyl)pyrrole, 2,5-Dimethyl-1-(4-nitrophenyl)pyrrole, 98%, 2,5–DIMETHYL–1–(4–NITROPHENYL)–1H–PYRROLE, 2,5-Dimethyl-1-(4-nitrophenyl)-1H-pyrrole, 98%. Offered by: Biosynth, Chemat, Combi-blocks, GLPBio, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g.
2,5-dimethyl-1-(4-nitrophenyl)pyrrole (CAS 5044-22-4) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 2,5-dimethyl-1-(4-nitrophenyl)pyrrole. InChIKey: JXJRCFOGAIXRCU-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 2,5-dimethyl-1-(4-nitrophenyl)pyrrole |
| InChIKey | JXJRCFOGAIXRCU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)