cas: 2096339-92-1 — see every product listed under this CAS number, including other names
2,6-Bis(benzyloxy)pyridine-3-boronic acid 98% (CAS 2096339-92-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A757865-250mg |
| cas | 2096339-92-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 25g | 1388.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A757865 |
[2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid (CAS 2096339-92-1) is a chemical compound with the molecular formula C19H18BNO4 and a molecular weight of 335.2 g/mol. IUPAC name: [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid. InChIKey: KWEZFPLDOCKBPB-UHFFFAOYSA-N.
| Molecular formula | C19H18BNO4 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid |
| InChIKey | KWEZFPLDOCKBPB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)