CAS 681812-07-7 appears in our catalog under these names: 2,6-Bis(trifluoromethyl)phenylboronic acid, 98%, 2,6-Bis-(trifluoromethyl)phenylboronic acid/ 95+%, 2,6-Bis(trifluoromethyl)benzeneboronic acid, 97% , 2,6-Bis(trifluoromethyl)phenylboronic Acid 98%, (2,6-Bis(trifluoromethyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 100mg.
[2,6-bis(trifluoromethyl)phenyl]boronic acid (CAS 681812-07-7) is a chemical compound with the molecular formula C8H5BF6O2 and a molecular weight of 257.93 g/mol. IUPAC name: [2,6-bis(trifluoromethyl)phenyl]boronic acid. InChIKey: WAMPGNNEOZGBHR-UHFFFAOYSA-N.
| Molecular formula | C8H5BF6O2 |
|---|---|
| Molecular weight | 257.93 g/mol |
| IUPAC name | [2,6-bis(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WAMPGNNEOZGBHR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C(F)(F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)