cas: 34593-79-8 — see every product listed under this CAS number, including other names
2,6-DIBROMO-4-(1,1-DIMETHYLPROPYL)PHENOL, 95%+ (CAS 34593-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XAJD-100mg |
| cas | 34593-79-8 |
| size | 100mg |
| availability | 1.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln | |
| Chemat | 250mg | 3506.00 Pln | |
| Chemat | 1g | 5574.80 Pln | |
| Fluorochem | 100mg | 3934.05 Pln | |
| Fluorochem | 250mg | 6381.10 Pln | |
| Fluorochem | 1g | 10166.23 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2,6-dibromo-4-(2-methylbutan-2-yl)phenol (CAS 34593-79-8) is a chemical compound with the molecular formula C11H14Br2O and a molecular weight of 322.04 g/mol. IUPAC name: 2,6-dibromo-4-(2-methylbutan-2-yl)phenol. InChIKey: GCVTUCNNHKLASF-UHFFFAOYSA-N.
| Molecular formula | C11H14Br2O |
|---|---|
| Molecular weight | 322.04 g/mol |
| IUPAC name | 2,6-dibromo-4-(2-methylbutan-2-yl)phenol |
| InChIKey | GCVTUCNNHKLASF-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C(=C1)Br)O)Br |
Computed by PubChem (NCBI)