CAS 34593-79-8 appears in our catalog under these names: 2,6-Dibromo-4-(tert-pentyl)phenol, 98%, 2，6-Dibromo-4-(1，1-dimethylpropyl)phenol, 95%+, 95%+, 2,6-DIBROMO-4-(1,1-DIMETHYLPROPYL)PHENOL, 95%+. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,6-dibromo-4-(2-methylbutan-2-yl)phenol (CAS 34593-79-8) is a chemical compound with the molecular formula C11H14Br2O and a molecular weight of 322.04 g/mol. IUPAC name: 2,6-dibromo-4-(2-methylbutan-2-yl)phenol. InChIKey: GCVTUCNNHKLASF-UHFFFAOYSA-N.
| Molecular formula | C11H14Br2O |
|---|---|
| Molecular weight | 322.04 g/mol |
| IUPAC name | 2,6-dibromo-4-(2-methylbutan-2-yl)phenol |
| InChIKey | GCVTUCNNHKLASF-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C(=C1)Br)O)Br |
Computed by PubChem (NCBI)