cas: 1473423-59-4 — see every product listed under this CAS number, including other names
2,6-DICHLORO-4-FLUOROBENZONITRILE, 97% (CAS 1473423-59-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538842-250MG |
| cas | 1473423-59-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 414.46 Pln | |
| Fluorochem | 25g | 815.36 Pln | |
| Fluorochem | 100g | 2944.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dichloro-4-fluorobenzonitrile (CAS 1473423-59-4) is a chemical compound with the molecular formula C7H2Cl2FN and a molecular weight of 190.00 g/mol. IUPAC name: 2,6-dichloro-4-fluorobenzonitrile. InChIKey: UAOCIVQQKRQKRF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN |
|---|---|
| Molecular weight | 190.00 g/mol |
| IUPAC name | 2,6-dichloro-4-fluorobenzonitrile |
| InChIKey | UAOCIVQQKRQKRF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C#N)Cl)F |
Computed by PubChem (NCBI)