CAS 1349719-19-2 is the registry number for 3,4-Dichloro-5-fluorobenzonitrile, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
3,4-dichloro-5-fluorobenzonitrile (CAS 1349719-19-2) is a chemical compound with the molecular formula C7H2Cl2FN and a molecular weight of 190.00 g/mol. IUPAC name: 3,4-dichloro-5-fluorobenzonitrile. InChIKey: WYOMVONBBWJBHB-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN |
|---|---|
| Molecular weight | 190.00 g/mol |
| IUPAC name | 3,4-dichloro-5-fluorobenzonitrile |
| InChIKey | WYOMVONBBWJBHB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)Cl)C#N |
Computed by PubChem (NCBI)