CAS 161612-68-6 appears in our catalog under these names: 2,4–Dichloro–3–fluorobenzonitrile, 2,4-Dichloro-3-fluorobenzonitrile, 97%, 97%, 2,4-Dichloro-3-fluorobenzonitrile, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2,4-dichloro-3-fluorobenzonitrile (CAS 161612-68-6) is a chemical compound with the molecular formula C7H2Cl2FN and a molecular weight of 190.00 g/mol. IUPAC name: 2,4-dichloro-3-fluorobenzonitrile. InChIKey: QWGPQHZYZNHITN-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN |
|---|---|
| Molecular weight | 190.00 g/mol |
| IUPAC name | 2,4-dichloro-3-fluorobenzonitrile |
| InChIKey | QWGPQHZYZNHITN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)Cl)F)Cl |
Computed by PubChem (NCBI)