CAS 103879-31-8 appears in our catalog under these names: 3,5-Dichloro-4-fluorobenzonitrile 97%, 3,5-Dichloro-4-fluorobenzonitrile, 98%, 98%, 3,5-Dichloro-4-fluorobenzonitrile, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
3,5-dichloro-4-fluorobenzonitrile (CAS 103879-31-8) is a chemical compound with the molecular formula C7H2Cl2FN and a molecular weight of 190.00 g/mol. IUPAC name: 3,5-dichloro-4-fluorobenzonitrile. InChIKey: RIOPZMHLYZUNFX-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN |
|---|---|
| Molecular weight | 190.00 g/mol |
| IUPAC name | 3,5-dichloro-4-fluorobenzonitrile |
| InChIKey | RIOPZMHLYZUNFX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)C#N |
Computed by PubChem (NCBI)