cas: 1129-30-2 — see every product listed under this CAS number, including other names
2,6-Diacetylpyridine 97% (CAS 1129-30-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106259-250mg |
| cas | 1129-30-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 409.31 Pln | |
| Ambeed | 500g | 1605.25 Pln | |
| Ambeed | 1000g | 2940.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A106259 |
1-(6-acetyl-2-pyridinyl)ethanone (CAS 1129-30-2) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 1-(6-acetyl-2-pyridinyl)ethanone. InChIKey: BEZVGIHGZPLGBL-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | 1-(6-acetyl-2-pyridinyl)ethanone |
| InChIKey | BEZVGIHGZPLGBL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=CC=C1)C(=O)C |
Computed by PubChem (NCBI)