CAS 1129-30-2 appears in our catalog under these names: 2,6–Diacetylpyridine, 2,6-Diacetylpyridine, 99% , 2,6-Diacetylpyridine, 2,6-Diacetylpyridine, >98.0%(GC), 2,6-Diacetylpyridine, 99%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 5g, 1g, 50g, 250g, 500g, 1000g.
1-(6-acetyl-2-pyridinyl)ethanone (CAS 1129-30-2) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 1-(6-acetyl-2-pyridinyl)ethanone. InChIKey: BEZVGIHGZPLGBL-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | 1-(6-acetyl-2-pyridinyl)ethanone |
| InChIKey | BEZVGIHGZPLGBL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=CC=C1)C(=O)C |
Computed by PubChem (NCBI)