cas: 10546-66-4 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-n-butylaniline (CAS 10546-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037553-1G |
| cas | 10546-66-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1122.54 Pln |
| delivery time | 2-3 weeks |
|---|
2,6-dibromo-4-butylaniline (CAS 10546-66-4) is a chemical compound with the molecular formula C10H13Br2N and a molecular weight of 307.02 g/mol. IUPAC name: 2,6-dibromo-4-butylaniline. InChIKey: HVEXPCBRDISAGF-UHFFFAOYSA-N.
| Molecular formula | C10H13Br2N |
|---|---|
| Molecular weight | 307.02 g/mol |
| IUPAC name | 2,6-dibromo-4-butylaniline |
| InChIKey | HVEXPCBRDISAGF-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC(=C(C(=C1)Br)N)Br |
Computed by PubChem (NCBI)