cas: 35852-57-4 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-trifluoromethylphenol (CAS 35852-57-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033226-1G |
| cas | 35852-57-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 10g | 4673.37 Pln |
| delivery time | 2-3 weeks |
|---|
2,6-dibromo-4-(trifluoromethyl)phenol (CAS 35852-57-4) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 2,6-dibromo-4-(trifluoromethyl)phenol. InChIKey: IEMNQLAXBXXIKT-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 2,6-dibromo-4-(trifluoromethyl)phenol |
| InChIKey | IEMNQLAXBXXIKT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)