cas: 2096340-19-9 — see every product listed under this CAS number, including other names
2,6-Dibromopyridine-4-boronic acid, 97%(HPLC),RG, 97%(HPLC),RG (CAS 2096340-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHMR-100mg |
| cas | 2096340-19-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 2834.00 Pln |
| purity | 97%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
(2,6-dibromo-4-pyridinyl)boronic acid (CAS 2096340-19-9) is a chemical compound with the molecular formula C5H4BBr2NO2 and a molecular weight of 280.71 g/mol. IUPAC name: (2,6-dibromo-4-pyridinyl)boronic acid. InChIKey: WXFBYDLBSSITNV-UHFFFAOYSA-N.
| Molecular formula | C5H4BBr2NO2 |
|---|---|
| Molecular weight | 280.71 g/mol |
| IUPAC name | (2,6-dibromo-4-pyridinyl)boronic acid |
| InChIKey | WXFBYDLBSSITNV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Br)Br)(O)O |
Computed by PubChem (NCBI)