CAS 1256355-52-8 appears in our catalog under these names: 2,6-Dibromopyridine-3-boronic acid, 98%, (2,6-Dibromopyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
(2,6-dibromo-3-pyridinyl)boronic acid (CAS 1256355-52-8) is a chemical compound with the molecular formula C5H4BBr2NO2 and a molecular weight of 280.71 g/mol. IUPAC name: (2,6-dibromo-3-pyridinyl)boronic acid. InChIKey: PTTWODKSMWAAHP-UHFFFAOYSA-N.
| Molecular formula | C5H4BBr2NO2 |
|---|---|
| Molecular weight | 280.71 g/mol |
| IUPAC name | (2,6-dibromo-3-pyridinyl)boronic acid |
| InChIKey | PTTWODKSMWAAHP-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Br)Br)(O)O |
Computed by PubChem (NCBI)