Products 1031843-77-2

CAS 1031843-77-2 appears in our catalog under these names: 2,5-Dibromo-4-pyridinylboronic acid, 98%, (2,5–Dibromopyridin–4–yl)boronic acid, (2,5-Dibromopyridin-4-yl)boronic acid 98%, (2,5-Dibromopyridin-4-yl)boronic acid, 98%, 98%, (2,5-Dibromopyridin-4-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 500mg, 250mg.

Structural formula: {0} (CAS {1})

(2,5-dibromo-4-pyridinyl)boronic acid (CAS 1031843-77-2) is a chemical compound with the molecular formula C5H4BBr2NO2 and a molecular weight of 280.71 g/mol. IUPAC name: (2,5-dibromo-4-pyridinyl)boronic acid. InChIKey: GIYVWMBVVVLFIG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BBr2NO2
Molecular weight280.71 g/mol
IUPAC name(2,5-dibromo-4-pyridinyl)boronic acid
InChIKeyGIYVWMBVVVLFIG-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1Br)Br)(O)O

Computed by PubChem (NCBI)