cas: 2096340-19-9 — see every product listed under this CAS number, including other names
2,6–Dibromopyridine–4–boronic acid (CAS 2096340-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF38619-100mg |
| cas | 2096340-19-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 531.51 Pln | |
| GLPBio | 1g | 1088.49 Pln | |
| GLPBio | 250mg | 639.16 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,6-dibromo-4-pyridinyl)boronic acid (CAS 2096340-19-9) is a chemical compound with the molecular formula C5H4BBr2NO2 and a molecular weight of 280.71 g/mol. IUPAC name: (2,6-dibromo-4-pyridinyl)boronic acid. InChIKey: WXFBYDLBSSITNV-UHFFFAOYSA-N.
| Molecular formula | C5H4BBr2NO2 |
|---|---|
| Molecular weight | 280.71 g/mol |
| IUPAC name | (2,6-dibromo-4-pyridinyl)boronic acid |
| InChIKey | WXFBYDLBSSITNV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Br)Br)(O)O |
Computed by PubChem (NCBI)