cas: 4887-95-0 — see every product listed under this CAS number, including other names
2,6-Dichloro-1H-benzo[d]imidazole 98% (CAS 4887-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A872592-100mg |
| cas | 4887-95-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1549.62 Pln | |
| Ambeed | 10g | 2278.31 Pln | |
| Ambeed | 25g | 4497.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A872592 |
2,6-dichloro-1H-benzimidazole (CAS 4887-95-0) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2,6-dichloro-1H-benzimidazole. InChIKey: LLIARSREYVCQHL-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2,6-dichloro-1H-benzimidazole |
| InChIKey | LLIARSREYVCQHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)Cl |
Computed by PubChem (NCBI)