cas: 58671-77-5 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-methylbenzoic acid (CAS 58671-77-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632682-1G |
| cas | 58671-77-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1716.08 Pln | |
| Fluorochem | 5g | 5001.38 Pln |
| delivery time | 3-4 weeks |
|---|
2,6-dichloro-3-methylbenzoic acid (CAS 58671-77-5) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2,6-dichloro-3-methylbenzoic acid. InChIKey: AZSPVSLYCSUHIT-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2,6-dichloro-3-methylbenzoic acid |
| InChIKey | AZSPVSLYCSUHIT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)