2,6-Dichloro-4-nitrobenzo[d]thiazole, 97%
cas: 1379329-41-5 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-nitrobenzo[d]thiazole, 97% (CAS 1379329-41-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1439333-250mg |
| cas | 1379329-41-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 937.75 Pln | |
| Ambeed | 1g | 2066.94 Pln | |
| BLDpharm | 50mg | 442.09 Pln | |
| BLDpharm | 100mg | 653.13 Pln | |
| BLDpharm | 250mg | 1003.00 Pln | |
| BLDpharm | 1g | 2219.24 Pln | |
| Chemat | 50mg | 467.60 Pln | |
| Chemat | 100mg | 707.60 Pln | |
| Chemat | 250mg | 1091.60 Pln | |
| Chemat | 1g | 2426.00 Pln | |
| Fluorochem | 50mg | 851.80 Pln | |
| Fluorochem | 100mg | 1304.77 Pln | |
| Fluorochem | 250mg | 2023.26 Pln | |
| Fluorochem | 1g | 4485.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,6-dichloro-4-nitro-1,3-benzothiazole (CAS 1379329-41-5) is a chemical compound with the molecular formula C7H2Cl2N2O2S and a molecular weight of 249.07 g/mol. IUPAC name: 2,6-dichloro-4-nitro-1,3-benzothiazole. InChIKey: VBXOKINKCGFIAF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2N2O2S |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 2,6-dichloro-4-nitro-1,3-benzothiazole |
| InChIKey | VBXOKINKCGFIAF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1[N+](=O)[O-])N=C(S2)Cl)Cl |
Computed by PubChem (NCBI)