CAS 70200-91-8 appears in our catalog under these names: 2,4-Dichloro-7-nitro-1,3-benzothiazole, 95%, 2,4-Dichloro-7-nitro-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4-dichloro-7-nitro-1,3-benzothiazole (CAS 70200-91-8) is a chemical compound with the molecular formula C7H2Cl2N2O2S and a molecular weight of 249.07 g/mol. IUPAC name: 2,4-dichloro-7-nitro-1,3-benzothiazole. InChIKey: WHTLBRHYORVOHB-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2N2O2S |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 2,4-dichloro-7-nitro-1,3-benzothiazole |
| InChIKey | WHTLBRHYORVOHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1[N+](=O)[O-])SC(=N2)Cl)Cl |
Computed by PubChem (NCBI)