CAS 22133-98-8 is the registry number for 1,3-Dichloro-2-isothiocyanato-5-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dichloro-2-isothiocyanato-5-nitrobenzene (CAS 22133-98-8) is a chemical compound with the molecular formula C7H2Cl2N2O2S and a molecular weight of 249.07 g/mol. IUPAC name: 1,3-dichloro-2-isothiocyanato-5-nitrobenzene. InChIKey: ARLQFLWEKBDYGQ-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2N2O2S |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 1,3-dichloro-2-isothiocyanato-5-nitrobenzene |
| InChIKey | ARLQFLWEKBDYGQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N=C=S)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)