CAS 2243507-48-2 is the registry number for 2,5-Dichloro-4-nitrobenzo(d)thiazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,5-dichloro-4-nitro-1,3-benzothiazole (CAS 2243507-48-2) is a chemical compound with the molecular formula C7H2Cl2N2O2S and a molecular weight of 249.07 g/mol. IUPAC name: 2,5-dichloro-4-nitro-1,3-benzothiazole. InChIKey: AZKSOPCCDWGCJD-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2N2O2S |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 2,5-dichloro-4-nitro-1,3-benzothiazole |
| InChIKey | AZKSOPCCDWGCJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1SC(=N2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)