cas: 2121512-61-4 — see every product listed under this CAS number, including other names
2,6-Difluoro-3-formylphenylboronic acid pinacol ester, 98%, 98% (CAS 2121512-61-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K03R-100mg |
| cas | 2121512-61-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1010.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2121512-61-4) is a chemical compound with the molecular formula C13H15BF2O3 and a molecular weight of 268.07 g/mol. IUPAC name: 2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: FJXPIHMLJAUNHF-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O3 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | FJXPIHMLJAUNHF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)C=O)F |
Computed by PubChem (NCBI)