cas: 2121512-61-4 — see every product listed under this CAS number, including other names
2,6-Difluoro-3-formylphenylboronic acid pinacol ester (CAS 2121512-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627569-1G |
| cas | 2121512-61-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1497.41 Pln | |
| Fluorochem | 5g | 4329.74 Pln |
| delivery time | 3-4 weeks |
|---|
2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2121512-61-4) is a chemical compound with the molecular formula C13H15BF2O3 and a molecular weight of 268.07 g/mol. IUPAC name: 2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: FJXPIHMLJAUNHF-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O3 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | FJXPIHMLJAUNHF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)C=O)F |
Computed by PubChem (NCBI)