cas: 25892-09-5 — see every product listed under this CAS number, including other names
2,6-Difluoro-3-nitroaniline 97% (CAS 25892-09-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A219193-250mg |
| cas | 25892-09-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 153.44 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1377.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A219193 |
2,6-difluoro-3-nitroaniline (CAS 25892-09-5) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,6-difluoro-3-nitroaniline. InChIKey: NNPVREQNMNPOAK-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,6-difluoro-3-nitroaniline |
| InChIKey | NNPVREQNMNPOAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)N)F |
Computed by PubChem (NCBI)