CAS 25892-09-5 appears in our catalog under these names: 2,6-Difluoro-3-nitroaniline, 97%, 97%, 2,6-Difluoro-3-nitroaniline, 98%, 2,6-Difluoro-3-nitroaniline, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g.
2,6-difluoro-3-nitroaniline (CAS 25892-09-5) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,6-difluoro-3-nitroaniline. InChIKey: NNPVREQNMNPOAK-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,6-difluoro-3-nitroaniline |
| InChIKey | NNPVREQNMNPOAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)N)F |
Computed by PubChem (NCBI)