CAS 211693-73-1 appears in our catalog under these names: 2,3–Difluoro–6–nitroaniline, 2,3-Difluoro-6-nitroaniline, 2,3-Difluoro-6-nitroaniline 97%, 2,3-Difluoro-6-nitroaniline, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 1g, 0,5g, 5g, 1000g, 250mg, 10g.
2,3-difluoro-6-nitroaniline (CAS 211693-73-1) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-6-nitroaniline. InChIKey: DIPGYZSCGXBTEU-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,3-difluoro-6-nitroaniline |
| InChIKey | DIPGYZSCGXBTEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)F)F |
Computed by PubChem (NCBI)