CAS 292145-76-7 is the registry number for 3,4-Difluoro-2-nitroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,4-difluoro-2-nitroaniline (CAS 292145-76-7) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 3,4-difluoro-2-nitroaniline. InChIKey: DHGFEUWOJVVCPZ-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 3,4-difluoro-2-nitroaniline |
| InChIKey | DHGFEUWOJVVCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)