cas: 1204333-58-3 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 98% (CAS 1204333-58-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A434448-100mg |
| cas | 1204333-58-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1594.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A434448 |
2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1204333-58-3) is a chemical compound with the molecular formula C11H14BF2NO2 and a molecular weight of 241.04 g/mol. IUPAC name: 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: FUGGRIAHIVRPNM-UHFFFAOYSA-N.
| Molecular formula | C11H14BF2NO2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | FUGGRIAHIVRPNM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)F)F |
Computed by PubChem (NCBI)