CAS 1310404-59-1 is the registry number for 3,5-Difluoropyridine-4-boronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1310404-59-1) is a chemical compound with the molecular formula C11H14BF2NO2 and a molecular weight of 241.04 g/mol. IUPAC name: 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: OSFFIGWRPWPBRL-UHFFFAOYSA-N.
| Molecular formula | C11H14BF2NO2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | OSFFIGWRPWPBRL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2F)F |
Computed by PubChem (NCBI)