cas: 1204333-58-3 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97% (CAS 1204333-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319943-250MG |
| cas | 1204333-58-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1591.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1204333-58-3) is a chemical compound with the molecular formula C11H14BF2NO2 and a molecular weight of 241.04 g/mol. IUPAC name: 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: FUGGRIAHIVRPNM-UHFFFAOYSA-N.
| Molecular formula | C11H14BF2NO2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | FUGGRIAHIVRPNM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)F)F |
Computed by PubChem (NCBI)