Products 1443380-15-1
CAS 1443380-15-1 is the registry number for 2,3-Difluoro-4-piperidinophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2,3-difluoro-4-piperidin-1-ylphenyl)boronic acid (CAS 1443380-15-1) is a chemical compound with the molecular formula C11H14BF2NO2 and a molecular weight of 241.04 g/mol. IUPAC name: (2,3-difluoro-4-piperidin-1-ylphenyl)boronic acid. InChIKey: XVHZOHDPQCQVDE-UHFFFAOYSA-N.
| Molecular formula | C11H14BF2NO2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | (2,3-difluoro-4-piperidin-1-ylphenyl)boronic acid |
| InChIKey | XVHZOHDPQCQVDE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)N2CCCCC2)F)F)(O)O |
Computed by PubChem (NCBI)