CAS 2096996-99-3 appears in our catalog under these names: 2,3–Difluoro–4–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)pyridine, 2,3-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 97%, (2,3-DIFLUOROPYRIDIN-4-YL)BORONIC ACID PINACOL ESTER, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2096996-99-3) is a chemical compound with the molecular formula C11H14BF2NO2 and a molecular weight of 241.04 g/mol. IUPAC name: 2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: GTIQBAKMCOOWIS-UHFFFAOYSA-N.
| Molecular formula | C11H14BF2NO2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | GTIQBAKMCOOWIS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)F)F |
Computed by PubChem (NCBI)