cas: 60230-36-6 — see every product listed under this CAS number, including other names
2,6-Difluorobenzenesulfonyl Chloride, >98.0%(GC)(T) (CAS 60230-36-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2940-1G |
| cas | 60230-36-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 188.68 Pln | |
| TCI | 5g | 424.70 Pln | |
| TCI | 25g | 1329.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,6-difluorobenzenesulfonyl chloride (CAS 60230-36-6) is a chemical compound with the molecular formula C6H3ClF2O2S and a molecular weight of 212.60 g/mol. IUPAC name: 2,6-difluorobenzenesulfonyl chloride. InChIKey: QXWAUQMMMIMLTO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF2O2S |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | 2,6-difluorobenzenesulfonyl chloride |
| InChIKey | QXWAUQMMMIMLTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)